C14H17NO3S — CID 168704315
S-[1-[1-(4-hydroxyphenyl)ethyl]-5-oxopyrrolidin-3-yl] ethanethioate (PubChem CID 168704315) has the molecular formula C14H17NO3S and a molecular weight of 279.36 g/mol. Its IUPAC name is S-[1-[1-(4-hydroxyphenyl)ethyl]-5-oxopyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[1-[1-(4-hydroxyphenyl)ethyl]-5-oxopyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168704315 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | S-[1-[1-(4-hydroxyphenyl)ethyl]-5-oxopyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CC(=O)N(C(C)c2ccc(O)cc2)C1 |
| InChI | InChI=1S/C14H17NO3S/c1-9(11-3-5-12(17)6-4-11)15-8-13(7-14(15)18)19-10(2)16/h3-6,9,13,17H,7-8H2,1-2H3 |
| InChIKey | QWVBBVGTTFLMIW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|