C11H17NO4S — CID 168704266
2-(4-acetylsulfanyl-2-oxopyrrolidin-1-yl)-3-methylbutanoic acid (PubChem CID 168704266) has the molecular formula C11H17NO4S and a molecular weight of 259.33 g/mol. Its IUPAC name is 2-(4-acetylsulfanyl-2-oxopyrrolidin-1-yl)-3-methylbutanoic acid.
| Compound Name | 2-(4-acetylsulfanyl-2-oxopyrrolidin-1-yl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 168704266 |
| Molecular Formula | C11H17NO4S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 2-(4-acetylsulfanyl-2-oxopyrrolidin-1-yl)-3-methylbutanoic acid |
| SMILES | CC(=O)SC1CC(=O)N(C(C(=O)O)C(C)C)C1 |
| InChI | InChI=1S/C11H17NO4S/c1-6(2)10(11(15)16)12-5-8(4-9(12)14)17-7(3)13/h6,8,10H,4-5H2,1-3H3,(H,15,16) |
| InChIKey | YEALQSNYGXZIJT-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|