C15H19NO2S — CID 168704367
S-[5-oxo-1-(1-phenylpropyl)pyrrolidin-3-yl] ethanethioate (PubChem CID 168704367) has the molecular formula C15H19NO2S and a molecular weight of 277.39 g/mol. Its IUPAC name is S-[5-oxo-1-(1-phenylpropyl)pyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[5-oxo-1-(1-phenylpropyl)pyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168704367 |
| Molecular Formula | C15H19NO2S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | S-[5-oxo-1-(1-phenylpropyl)pyrrolidin-3-yl] ethanethioate |
| SMILES | CCC(c1ccccc1)N1CC(SC(C)=O)CC1=O |
| InChI | InChI=1S/C15H19NO2S/c1-3-14(12-7-5-4-6-8-12)16-10-13(9-15(16)18)19-11(2)17/h4-8,13-14H,3,9-10H2,1-2H3 |
| InChIKey | IIHDIKLGCSLWMM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|