C16H21NO4S — CID 168704309
S-[1-[1-(2,5-dimethoxyphenyl)ethyl]-5-oxopyrrolidin-3-yl] ethanethioate (PubChem CID 168704309) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is S-[1-[1-(2,5-dimethoxyphenyl)ethyl]-5-oxopyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[1-[1-(2,5-dimethoxyphenyl)ethyl]-5-oxopyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168704309 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | S-[1-[1-(2,5-dimethoxyphenyl)ethyl]-5-oxopyrrolidin-3-yl] ethanethioate |
| SMILES | COc1ccc(OC)c(C(C)N2CC(SC(C)=O)CC2=O)c1 |
| InChI | InChI=1S/C16H21NO4S/c1-10(14-7-12(20-3)5-6-15(14)21-4)17-9-13(8-16(17)19)22-11(2)18/h5-7,10,13H,8-9H2,1-4H3 |
| InChIKey | DMHSEVUHKHGOBC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|