C12H13BrClNO3S — CID 168710964
1-[(1S)-1-(4-bromophenyl)ethyl]-5-oxopyrrolidine-3-sulfonyl chloride (PubChem CID 168710964) has the molecular formula C12H13BrClNO3S and a molecular weight of 366.66 g/mol. Its IUPAC name is 1-[(1S)-1-(4-bromophenyl)ethyl]-5-oxopyrrolidine-3-sulfonyl chloride.
| Compound Name | 1-[(1S)-1-(4-bromophenyl)ethyl]-5-oxopyrrolidine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 168710964 |
| Molecular Formula | C12H13BrClNO3S |
| Molecular Weight | 366.66 g/mol |
| Exact Mass | 364.95 |
| IUPAC Name | 1-[(1S)-1-(4-bromophenyl)ethyl]-5-oxopyrrolidine-3-sulfonyl chloride |
| SMILES | C[C@@H](c1ccc(Br)cc1)N1CC(S(=O)(=O)Cl)CC1=O |
| InChI | InChI=1S/C12H13BrClNO3S/c1-8(9-2-4-10(13)5-3-9)15-7-11(6-12(15)16)19(14,17)18/h2-5,8,11H,6-7H2,1H3/t8-,11?/m0/s1 |
| InChIKey | LPMUPAIFWWLJGP-YMNIQAILSA-N |
| XLogP | 2.68 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.66 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |