C13H16Cl2N2O — CID 168658795
4-(aminomethyl)-1-[1-(3,4-dichlorophenyl)ethyl]pyrrolidin-2-one (PubChem CID 168658795) has the molecular formula C13H16Cl2N2O and a molecular weight of 287.19 g/mol. Its IUPAC name is 4-(aminomethyl)-1-[1-(3,4-dichlorophenyl)ethyl]pyrrolidin-2-one.
| Compound Name | 4-(aminomethyl)-1-[1-(3,4-dichlorophenyl)ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168658795 |
| Molecular Formula | C13H16Cl2N2O |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 4-(aminomethyl)-1-[1-(3,4-dichlorophenyl)ethyl]pyrrolidin-2-one |
| SMILES | CC(c1ccc(Cl)c(Cl)c1)N1CC(CN)CC1=O |
| InChI | InChI=1S/C13H16Cl2N2O/c1-8(10-2-3-11(14)12(15)5-10)17-7-9(6-16)4-13(17)18/h2-3,5,8-9H,4,6-7,16H2,1H3 |
| InChIKey | PAZPUNSJZLNJKI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |