C12H15ClN2O3S — CID 168716499
1-[1-(3-chlorophenyl)ethyl]-5-oxopyrrolidine-3-sulfonamide (PubChem CID 168716499) has the molecular formula C12H15ClN2O3S and a molecular weight of 302.78 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)ethyl]-5-oxopyrrolidine-3-sulfonamide.
| Compound Name | 1-[1-(3-chlorophenyl)ethyl]-5-oxopyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168716499 |
| Molecular Formula | C12H15ClN2O3S |
| Molecular Weight | 302.78 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 1-[1-(3-chlorophenyl)ethyl]-5-oxopyrrolidine-3-sulfonamide |
| SMILES | CC(c1cccc(Cl)c1)N1CC(S(N)(=O)=O)CC1=O |
| InChI | InChI=1S/C12H15ClN2O3S/c1-8(9-3-2-4-10(13)5-9)15-7-11(6-12(15)16)19(14,17)18/h2-5,8,11H,6-7H2,1H3,(H2,14,17,18) |
| InChIKey | YTMBRXKZOLJILF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.78 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |