C14H18N2O6S — CID 168716580
3-(3-methoxyphenyl)-3-(2-oxo-4-sulfamoylpyrrolidin-1-yl)propanoic acid (PubChem CID 168716580) has the molecular formula C14H18N2O6S and a molecular weight of 342.37 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-3-(2-oxo-4-sulfamoylpyrrolidin-1-yl)propanoic acid.
| Compound Name | 3-(3-methoxyphenyl)-3-(2-oxo-4-sulfamoylpyrrolidin-1-yl)propanoic acid |
|---|---|
| PubChem CID | 168716580 |
| Molecular Formula | C14H18N2O6S |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 3-(3-methoxyphenyl)-3-(2-oxo-4-sulfamoylpyrrolidin-1-yl)propanoic acid |
| SMILES | COc1cccc(C(CC(=O)O)N2CC(S(N)(=O)=O)CC2=O)c1 |
| InChI | InChI=1S/C14H18N2O6S/c1-22-10-4-2-3-9(5-10)12(7-14(18)19)16-8-11(6-13(16)17)23(15,20)21/h2-5,11-12H,6-8H2,1H3,(H,18,19)(H2,15,20,21) |
| InChIKey | KAJNCKAQGKFPRK-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |