C13H15FN2O5S — CID 168716634
3-(2-fluorophenyl)-3-(2-oxo-4-sulfamoylpyrrolidin-1-yl)propanoic acid (PubChem CID 168716634) has the molecular formula C13H15FN2O5S and a molecular weight of 330.34 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-3-(2-oxo-4-sulfamoylpyrrolidin-1-yl)propanoic acid.
| Compound Name | 3-(2-fluorophenyl)-3-(2-oxo-4-sulfamoylpyrrolidin-1-yl)propanoic acid |
|---|---|
| PubChem CID | 168716634 |
| Molecular Formula | C13H15FN2O5S |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 3-(2-fluorophenyl)-3-(2-oxo-4-sulfamoylpyrrolidin-1-yl)propanoic acid |
| SMILES | NS(=O)(=O)C1CC(=O)N(C(CC(=O)O)c2ccccc2F)C1 |
| InChI | InChI=1S/C13H15FN2O5S/c14-10-4-2-1-3-9(10)11(6-13(18)19)16-7-8(5-12(16)17)22(15,20)21/h1-4,8,11H,5-7H2,(H,18,19)(H2,15,20,21) |
| InChIKey | UUQWKBOVDKSGJP-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |