C9H16N2O5S — CID 168716429
3-methyl-2-(2-oxo-4-sulfamoylpyrrolidin-1-yl)butanoic acid (PubChem CID 168716429) has the molecular formula C9H16N2O5S and a molecular weight of 264.30 g/mol. Its IUPAC name is 3-methyl-2-(2-oxo-4-sulfamoylpyrrolidin-1-yl)butanoic acid.
| Compound Name | 3-methyl-2-(2-oxo-4-sulfamoylpyrrolidin-1-yl)butanoic acid |
|---|---|
| PubChem CID | 168716429 |
| Molecular Formula | C9H16N2O5S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 3-methyl-2-(2-oxo-4-sulfamoylpyrrolidin-1-yl)butanoic acid |
| SMILES | CC(C)C(C(=O)O)N1CC(S(N)(=O)=O)CC1=O |
| InChI | InChI=1S/C9H16N2O5S/c1-5(2)8(9(13)14)11-4-6(3-7(11)12)17(10,15)16/h5-6,8H,3-4H2,1-2H3,(H,13,14)(H2,10,15,16) |
| InChIKey | USCRUPBJDYMTBO-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |