C8H14N2O6S — CID 168716351
3-hydroxy-2-(2-oxo-4-sulfamoylpyrrolidin-1-yl)butanoic acid (PubChem CID 168716351) has the molecular formula C8H14N2O6S and a molecular weight of 266.27 g/mol. Its IUPAC name is 3-hydroxy-2-(2-oxo-4-sulfamoylpyrrolidin-1-yl)butanoic acid.
| Compound Name | 3-hydroxy-2-(2-oxo-4-sulfamoylpyrrolidin-1-yl)butanoic acid |
|---|---|
| PubChem CID | 168716351 |
| Molecular Formula | C8H14N2O6S |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 3-hydroxy-2-(2-oxo-4-sulfamoylpyrrolidin-1-yl)butanoic acid |
| SMILES | CC(O)C(C(=O)O)N1CC(S(N)(=O)=O)CC1=O |
| InChI | InChI=1S/C8H14N2O6S/c1-4(11)7(8(13)14)10-3-5(2-6(10)12)17(9,15)16/h4-5,7,11H,2-3H2,1H3,(H,13,14)(H2,9,15,16) |
| InChIKey | NRAUFKZRWBWJDI-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |