C9H15NO4S — CID 168669110
3-hydroxy-2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]butanoic acid (PubChem CID 168669110) has the molecular formula C9H15NO4S and a molecular weight of 233.29 g/mol. Its IUPAC name is 3-hydroxy-2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]butanoic acid.
| Compound Name | 3-hydroxy-2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 168669110 |
| Molecular Formula | C9H15NO4S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 3-hydroxy-2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]butanoic acid |
| SMILES | CC(O)C(C(=O)O)N1CC(CS)CC1=O |
| InChI | InChI=1S/C9H15NO4S/c1-5(11)8(9(13)14)10-3-6(4-15)2-7(10)12/h5-6,8,11,15H,2-4H2,1H3,(H,13,14) |
| InChIKey | ZSLQFSRYPUEYHG-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|