C10H15NO5S — CID 168669478
(2S)-2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]pentanedioic acid (PubChem CID 168669478) has the molecular formula C10H15NO5S and a molecular weight of 261.30 g/mol. Its IUPAC name is (2S)-2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]pentanedioic acid.
| Compound Name | (2S)-2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]pentanedioic acid |
|---|---|
| PubChem CID | 168669478 |
| Molecular Formula | C10H15NO5S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | (2S)-2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]pentanedioic acid |
| SMILES | O=C(O)CC[C@@H](C(=O)O)N1CC(CS)CC1=O |
| InChI | InChI=1S/C10H15NO5S/c12-8-3-6(5-17)4-11(8)7(10(15)16)1-2-9(13)14/h6-7,17H,1-5H2,(H,13,14)(H,15,16)/t6?,7-/m0/s1 |
| InChIKey | RXEKERXGABERTG-MLWJPKLSSA-N |
| XLogP | 0.08 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|