C8H13NO6S2 — CID 168669419
2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]-3-sulfopropanoic acid (PubChem CID 168669419) has the molecular formula C8H13NO6S2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]-3-sulfopropanoic acid.
| Compound Name | 2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]-3-sulfopropanoic acid |
|---|---|
| PubChem CID | 168669419 |
| Molecular Formula | C8H13NO6S2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 2-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]-3-sulfopropanoic acid |
| SMILES | O=C(O)C(CS(=O)(=O)O)N1CC(CS)CC1=O |
| InChI | InChI=1S/C8H13NO6S2/c10-7-1-5(3-16)2-9(7)6(8(11)12)4-17(13,14)15/h5-6,16H,1-4H2,(H,11,12)(H,13,14,15) |
| InChIKey | AKDMDPAYACIBEK-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|