C9H14N2O7S — CID 168680383
2-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]butanedioic acid (PubChem CID 168680383) has the molecular formula C9H14N2O7S and a molecular weight of 294.29 g/mol. Its IUPAC name is 2-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]butanedioic acid.
| Compound Name | 2-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]butanedioic acid |
|---|---|
| PubChem CID | 168680383 |
| Molecular Formula | C9H14N2O7S |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 2-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]butanedioic acid |
| SMILES | NS(=O)(=O)CC1CC(=O)N(C(CC(=O)O)C(=O)O)C1 |
| InChI | InChI=1S/C9H14N2O7S/c10-19(17,18)4-5-1-7(12)11(3-5)6(9(15)16)2-8(13)14/h5-6H,1-4H2,(H,13,14)(H,15,16)(H2,10,17,18) |
| InChIKey | TZYYYRBSISKXJC-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 155.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |