C15H20N2O5S — CID 168680411
2-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]-4-phenylbutanoic acid (PubChem CID 168680411) has the molecular formula C15H20N2O5S and a molecular weight of 340.40 g/mol. Its IUPAC name is 2-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]-4-phenylbutanoic acid.
| Compound Name | 2-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 168680411 |
| Molecular Formula | C15H20N2O5S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 2-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]-4-phenylbutanoic acid |
| SMILES | NS(=O)(=O)CC1CC(=O)N(C(CCc2ccccc2)C(=O)O)C1 |
| InChI | InChI=1S/C15H20N2O5S/c16-23(21,22)10-12-8-14(18)17(9-12)13(15(19)20)7-6-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2,(H,19,20)(H2,16,21,22) |
| InChIKey | OUSAEAINGAAFRH-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |