C11H18N2O7S — CID 168680322
(2S)-5-methoxy-5-oxo-2-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]pentanoic acid (PubChem CID 168680322) has the molecular formula C11H18N2O7S and a molecular weight of 322.34 g/mol. Its IUPAC name is (2S)-5-methoxy-5-oxo-2-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]pentanoic acid.
| Compound Name | (2S)-5-methoxy-5-oxo-2-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 168680322 |
| Molecular Formula | C11H18N2O7S |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | (2S)-5-methoxy-5-oxo-2-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]pentanoic acid |
| SMILES | COC(=O)CC[C@@H](C(=O)O)N1CC(CS(N)(=O)=O)CC1=O |
| InChI | InChI=1S/C11H18N2O7S/c1-20-10(15)3-2-8(11(16)17)13-5-7(4-9(13)14)6-21(12,18)19/h7-8H,2-6H2,1H3,(H,16,17)(H2,12,18,19)/t7?,8-/m0/s1 |
| InChIKey | MGBRGEGQKATVFN-MQWKRIRWSA-N |
| XLogP | -1.47 |
| TPSA | 144.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |