C10H18N2O5S2 — CID 168680339
(2S)-4-methylsulfanyl-2-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]butanoic acid (PubChem CID 168680339) has the molecular formula C10H18N2O5S2 and a molecular weight of 310.40 g/mol. Its IUPAC name is (2S)-4-methylsulfanyl-2-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]butanoic acid.
| Compound Name | (2S)-4-methylsulfanyl-2-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 168680339 |
| Molecular Formula | C10H18N2O5S2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | (2S)-4-methylsulfanyl-2-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]butanoic acid |
| SMILES | CSCC[C@@H](C(=O)O)N1CC(CS(N)(=O)=O)CC1=O |
| InChI | InChI=1S/C10H18N2O5S2/c1-18-3-2-8(10(14)15)12-5-7(4-9(12)13)6-19(11,16)17/h7-8H,2-6H2,1H3,(H,14,15)(H2,11,16,17)/t7?,8-/m0/s1 |
| InChIKey | ZGYYYFZCLGYXJN-MQWKRIRWSA-N |
| XLogP | -0.67 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |