C8H16N2O4S — CID 168680344
[1-[(2S)-1-hydroxypropan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonamide (PubChem CID 168680344) has the molecular formula C8H16N2O4S and a molecular weight of 236.29 g/mol. Its IUPAC name is [1-[(2S)-1-hydroxypropan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [1-[(2S)-1-hydroxypropan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168680344 |
| Molecular Formula | C8H16N2O4S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | [1-[(2S)-1-hydroxypropan-2-yl]-5-oxopyrrolidin-3-yl]methanesulfonamide |
| SMILES | C[C@@H](CO)N1CC(CS(N)(=O)=O)CC1=O |
| InChI | InChI=1S/C8H16N2O4S/c1-6(4-11)10-3-7(2-8(10)12)5-15(9,13)14/h6-7,11H,2-5H2,1H3,(H2,9,13,14)/t6-,7?/m0/s1 |
| InChIKey | RJSCGHKLCWIVSW-PKPIPKONSA-N |
| XLogP | -1.50 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |