C9H16ClNO3S — CID 168672525
(1-butan-2-yl-5-oxopyrrolidin-3-yl)methanesulfonyl chloride (PubChem CID 168672525) has the molecular formula C9H16ClNO3S and a molecular weight of 253.75 g/mol. Its IUPAC name is (1-butan-2-yl-5-oxopyrrolidin-3-yl)methanesulfonyl chloride.
| Compound Name | (1-butan-2-yl-5-oxopyrrolidin-3-yl)methanesulfonyl chloride |
|---|---|
| PubChem CID | 168672525 |
| Molecular Formula | C9H16ClNO3S |
| Molecular Weight | 253.75 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | (1-butan-2-yl-5-oxopyrrolidin-3-yl)methanesulfonyl chloride |
| SMILES | CCC(C)N1CC(CS(=O)(=O)Cl)CC1=O |
| InChI | InChI=1S/C9H16ClNO3S/c1-3-7(2)11-5-8(4-9(11)12)6-15(10,13)14/h7-8H,3-6H2,1-2H3 |
| InChIKey | MQBQOGHWIFYCAY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.75 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |