C19H20ClNO3S — CID 168672570
[1-[(4-methylphenyl)-phenylmethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride (PubChem CID 168672570) has the molecular formula C19H20ClNO3S and a molecular weight of 377.89 g/mol. Its IUPAC name is [1-[(4-methylphenyl)-phenylmethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride.
| Compound Name | [1-[(4-methylphenyl)-phenylmethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 168672570 |
| Molecular Formula | C19H20ClNO3S |
| Molecular Weight | 377.89 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | [1-[(4-methylphenyl)-phenylmethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
| SMILES | Cc1ccc(C(c2ccccc2)N2CC(CS(=O)(=O)Cl)CC2=O)cc1 |
| InChI | InChI=1S/C19H20ClNO3S/c1-14-7-9-17(10-8-14)19(16-5-3-2-4-6-16)21-12-15(11-18(21)22)13-25(20,23)24/h2-10,15,19H,11-13H2,1H3 |
| InChIKey | MTZYGKCMKQAVIT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.89 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |