C17H16FNO3S — CID 168714742
1-benzhydryl-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168714742) has the molecular formula C17H16FNO3S and a molecular weight of 333.38 g/mol. Its IUPAC name is 1-benzhydryl-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-benzhydryl-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168714742 |
| Molecular Formula | C17H16FNO3S |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 1-benzhydryl-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | O=C1CC(S(=O)(=O)F)CN1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H16FNO3S/c18-23(21,22)15-11-16(20)19(12-15)17(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15,17H,11-12H2 |
| InChIKey | UNJLSSRBNPDMSI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |