C13H13F2NO5S — CID 168713423
(2R)-3-(2-fluorophenyl)-2-(4-fluorosulfonyl-2-oxopyrrolidin-1-yl)propanoic acid (PubChem CID 168713423) has the molecular formula C13H13F2NO5S and a molecular weight of 333.31 g/mol. Its IUPAC name is (2R)-3-(2-fluorophenyl)-2-(4-fluorosulfonyl-2-oxopyrrolidin-1-yl)propanoic acid.
| Compound Name | (2R)-3-(2-fluorophenyl)-2-(4-fluorosulfonyl-2-oxopyrrolidin-1-yl)propanoic acid |
|---|---|
| PubChem CID | 168713423 |
| Molecular Formula | C13H13F2NO5S |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | (2R)-3-(2-fluorophenyl)-2-(4-fluorosulfonyl-2-oxopyrrolidin-1-yl)propanoic acid |
| SMILES | O=C(O)[C@@H](Cc1ccccc1F)N1CC(S(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C13H13F2NO5S/c14-10-4-2-1-3-8(10)5-11(13(18)19)16-7-9(6-12(16)17)22(15,20)21/h1-4,9,11H,5-7H2,(H,18,19)/t9?,11-/m1/s1 |
| InChIKey | HQIWSYIGJHRODR-HCCKASOXSA-N |
| XLogP | 0.72 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |