C10H16N2O4S — CID 168695770
(2S)-2-(4-carbamoyl-2-oxopyrrolidin-1-yl)-4-methylsulfanylbutanoic acid (PubChem CID 168695770) has the molecular formula C10H16N2O4S and a molecular weight of 260.31 g/mol. Its IUPAC name is (2S)-2-(4-carbamoyl-2-oxopyrrolidin-1-yl)-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-(4-carbamoyl-2-oxopyrrolidin-1-yl)-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 168695770 |
| Molecular Formula | C10H16N2O4S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | (2S)-2-(4-carbamoyl-2-oxopyrrolidin-1-yl)-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](C(=O)O)N1CC(C(N)=O)CC1=O |
| InChI | InChI=1S/C10H16N2O4S/c1-17-3-2-7(10(15)16)12-5-6(9(11)14)4-8(12)13/h6-7H,2-5H2,1H3,(H2,11,14)(H,15,16)/t6?,7-/m0/s1 |
| InChIKey | JYWNSOOAPDKYNV-MLWJPKLSSA-N |
| XLogP | -0.47 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |