C11H19N5O4 — CID 168695905
(2S)-2-(4-carbamoyl-2-oxopyrrolidin-1-yl)-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 168695905) has the molecular formula C11H19N5O4 and a molecular weight of 285.30 g/mol. Its IUPAC name is (2S)-2-(4-carbamoyl-2-oxopyrrolidin-1-yl)-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-(4-carbamoyl-2-oxopyrrolidin-1-yl)-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 168695905 |
| Molecular Formula | C11H19N5O4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | (2S)-2-(4-carbamoyl-2-oxopyrrolidin-1-yl)-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(=O)C1CC(=O)N([C@@H](CCCN=C(N)N)C(=O)O)C1 |
| InChI | InChI=1S/C11H19N5O4/c12-9(18)6-4-8(17)16(5-6)7(10(19)20)2-1-3-15-11(13)14/h6-7H,1-5H2,(H2,12,18)(H,19,20)(H4,13,14,15)/t6?,7-/m0/s1 |
| InChIKey | NCWYQCYBBLSJSZ-MLWJPKLSSA-N |
| XLogP | -2.17 |
| TPSA | 165.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|