C11H19ClN4O3 — CID 168506806
(2S)-2-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 168506806) has the molecular formula C11H19ClN4O3 and a molecular weight of 290.75 g/mol. Its IUPAC name is (2S)-2-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 168506806 |
| Molecular Formula | C11H19ClN4O3 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | (2S)-2-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCC[C@@H](C(=O)O)N1CC(CCl)CC1=O |
| InChI | InChI=1S/C11H19ClN4O3/c12-5-7-4-9(17)16(6-7)8(10(18)19)2-1-3-15-11(13)14/h7-8H,1-6H2,(H,18,19)(H4,13,14,15)/t7?,8-/m0/s1 |
| InChIKey | RABBLMVYZZXFTH-MQWKRIRWSA-N |
| XLogP | -0.42 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|