C12H20N4O5 — CID 168692755
5-(diaminomethylideneamino)-2-(4-methoxycarbonyl-2-oxopyrrolidin-1-yl)pentanoic acid (PubChem CID 168692755) has the molecular formula C12H20N4O5 and a molecular weight of 300.32 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-(4-methoxycarbonyl-2-oxopyrrolidin-1-yl)pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-(4-methoxycarbonyl-2-oxopyrrolidin-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 168692755 |
| Molecular Formula | C12H20N4O5 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-(4-methoxycarbonyl-2-oxopyrrolidin-1-yl)pentanoic acid |
| SMILES | COC(=O)C1CC(=O)N(C(CCCN=C(N)N)C(=O)O)C1 |
| InChI | InChI=1S/C12H20N4O5/c1-21-11(20)7-5-9(17)16(6-7)8(10(18)19)3-2-4-15-12(13)14/h7-8H,2-6H2,1H3,(H,18,19)(H4,13,14,15) |
| InChIKey | SNMYZUGVYHAQFW-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 148.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|