C10H18N4O3S — CID 168707813
5-(diaminomethylideneamino)-2-(2-oxo-4-sulfanylpyrrolidin-1-yl)pentanoic acid (PubChem CID 168707813) has the molecular formula C10H18N4O3S and a molecular weight of 274.35 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-(2-oxo-4-sulfanylpyrrolidin-1-yl)pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-(2-oxo-4-sulfanylpyrrolidin-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 168707813 |
| Molecular Formula | C10H18N4O3S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-(2-oxo-4-sulfanylpyrrolidin-1-yl)pentanoic acid |
| SMILES | NC(N)=NCCCC(C(=O)O)N1CC(S)CC1=O |
| InChI | InChI=1S/C10H18N4O3S/c11-10(12)13-3-1-2-7(9(16)17)14-5-6(18)4-8(14)15/h6-7,18H,1-5H2,(H,16,17)(H4,11,12,13) |
| InChIKey | GBDNSZBJFWTOHA-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|