C12H21NO3S — CID 168707725
tert-butyl (2R)-2-(2-oxo-4-sulfanylpyrrolidin-1-yl)butanoate (PubChem CID 168707725) has the molecular formula C12H21NO3S and a molecular weight of 259.37 g/mol. Its IUPAC name is tert-butyl (2R)-2-(2-oxo-4-sulfanylpyrrolidin-1-yl)butanoate.
| Compound Name | tert-butyl (2R)-2-(2-oxo-4-sulfanylpyrrolidin-1-yl)butanoate |
|---|---|
| PubChem CID | 168707725 |
| Molecular Formula | C12H21NO3S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | tert-butyl (2R)-2-(2-oxo-4-sulfanylpyrrolidin-1-yl)butanoate |
| SMILES | CC[C@H](C(=O)OC(C)(C)C)N1CC(S)CC1=O |
| InChI | InChI=1S/C12H21NO3S/c1-5-9(11(15)16-12(2,3)4)13-7-8(17)6-10(13)14/h8-9,17H,5-7H2,1-4H3/t8?,9-/m1/s1 |
| InChIKey | SRRNQPIHQKVDST-YGPZHTELSA-N |
| XLogP | 1.64 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|