C16H24N2O4 — CID 23531083
tert-butyl 2-[2-oxo-4-(prop-2-ynylcarbamoyl)pyrrolidin-1-yl]butanoate (PubChem CID 23531083) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is tert-butyl 2-[2-oxo-4-(prop-2-ynylcarbamoyl)pyrrolidin-1-yl]butanoate.
| Compound Name | tert-butyl 2-[2-oxo-4-(prop-2-ynylcarbamoyl)pyrrolidin-1-yl]butanoate |
|---|---|
| PubChem CID | 23531083 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | tert-butyl 2-[2-oxo-4-(prop-2-ynylcarbamoyl)pyrrolidin-1-yl]butanoate |
| SMILES | C#CCNC(=O)C1CC(=O)N(C(CC)C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H24N2O4/c1-6-8-17-14(20)11-9-13(19)18(10-11)12(7-2)15(21)22-16(3,4)5/h1,11-12H,7-10H2,2-5H3,(H,17,20) |
| InChIKey | OOPGQKXMEQVLON-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|