C9H15NO3S — CID 168707686
3-(2-oxo-4-sulfanylpyrrolidin-1-yl)pentanoic acid (PubChem CID 168707686) has the molecular formula C9H15NO3S and a molecular weight of 217.29 g/mol. Its IUPAC name is 3-(2-oxo-4-sulfanylpyrrolidin-1-yl)pentanoic acid.
| Compound Name | 3-(2-oxo-4-sulfanylpyrrolidin-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 168707686 |
| Molecular Formula | C9H15NO3S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | 3-(2-oxo-4-sulfanylpyrrolidin-1-yl)pentanoic acid |
| SMILES | CCC(CC(=O)O)N1CC(S)CC1=O |
| InChI | InChI=1S/C9H15NO3S/c1-2-6(3-9(12)13)10-5-7(14)4-8(10)11/h6-7,14H,2-5H2,1H3,(H,12,13) |
| InChIKey | XCULPDVFDUKGFW-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|