C7H13NO3S — CID 168709223
1-(1,3-dihydroxypropan-2-yl)-4-sulfanylpyrrolidin-2-one (PubChem CID 168709223) has the molecular formula C7H13NO3S and a molecular weight of 191.25 g/mol. Its IUPAC name is 1-(1,3-dihydroxypropan-2-yl)-4-sulfanylpyrrolidin-2-one.
| Compound Name | 1-(1,3-dihydroxypropan-2-yl)-4-sulfanylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168709223 |
| Molecular Formula | C7H13NO3S |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 1-(1,3-dihydroxypropan-2-yl)-4-sulfanylpyrrolidin-2-one |
| SMILES | O=C1CC(S)CN1C(CO)CO |
| InChI | InChI=1S/C7H13NO3S/c9-3-5(4-10)8-2-6(12)1-7(8)11/h5-6,9-10,12H,1-4H2 |
| InChIKey | UKKMWJDHFTYIDS-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|