C10H14N2O6 — CID 168695754
(3R)-3-(4-carbamoyl-2-oxopyrrolidin-1-yl)-4-methoxy-4-oxobutanoic acid (PubChem CID 168695754) has the molecular formula C10H14N2O6 and a molecular weight of 258.23 g/mol. Its IUPAC name is (3R)-3-(4-carbamoyl-2-oxopyrrolidin-1-yl)-4-methoxy-4-oxobutanoic acid.
| Compound Name | (3R)-3-(4-carbamoyl-2-oxopyrrolidin-1-yl)-4-methoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 168695754 |
| Molecular Formula | C10H14N2O6 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | (3R)-3-(4-carbamoyl-2-oxopyrrolidin-1-yl)-4-methoxy-4-oxobutanoic acid |
| SMILES | COC(=O)[C@@H](CC(=O)O)N1CC(C(N)=O)CC1=O |
| InChI | InChI=1S/C10H14N2O6/c1-18-10(17)6(3-8(14)15)12-4-5(9(11)16)2-7(12)13/h5-6H,2-4H2,1H3,(H2,11,16)(H,14,15)/t5?,6-/m1/s1 |
| InChIKey | CEQMLGAPMATJQE-PRJDIBJQSA-N |
| XLogP | -1.66 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |