C11H17NO5S — CID 168690223
1-(1-methoxy-4-methylsulfanyl-1-oxobutan-2-yl)-5-oxopyrrolidine-3-carboxylic acid (PubChem CID 168690223) has the molecular formula C11H17NO5S and a molecular weight of 275.33 g/mol. Its IUPAC name is 1-(1-methoxy-4-methylsulfanyl-1-oxobutan-2-yl)-5-oxopyrrolidine-3-carboxylic acid.
| Compound Name | 1-(1-methoxy-4-methylsulfanyl-1-oxobutan-2-yl)-5-oxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 168690223 |
| Molecular Formula | C11H17NO5S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 1-(1-methoxy-4-methylsulfanyl-1-oxobutan-2-yl)-5-oxopyrrolidine-3-carboxylic acid |
| SMILES | COC(=O)C(CCSC)N1CC(C(=O)O)CC1=O |
| InChI | InChI=1S/C11H17NO5S/c1-17-11(16)8(3-4-18-2)12-6-7(10(14)15)5-9(12)13/h7-8H,3-6H2,1-2H3,(H,14,15) |
| InChIKey | UAYNRKREBGATNV-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |