C9H16N2O3S — CID 23271461
methyl 2-(2-carbamoylaziridin-1-yl)-4-methylsulfanylbutanoate (PubChem CID 23271461) has the molecular formula C9H16N2O3S and a molecular weight of 232.30 g/mol. Its IUPAC name is methyl 2-(2-carbamoylaziridin-1-yl)-4-methylsulfanylbutanoate.
| Compound Name | methyl 2-(2-carbamoylaziridin-1-yl)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 23271461 |
| Molecular Formula | C9H16N2O3S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | methyl 2-(2-carbamoylaziridin-1-yl)-4-methylsulfanylbutanoate |
| SMILES | COC(=O)C(CCSC)N1CC1C(N)=O |
| InChI | InChI=1S/C9H16N2O3S/c1-14-9(13)6(3-4-15-2)11-5-7(11)8(10)12/h6-7H,3-5H2,1-2H3,(H2,10,12) |
| InChIKey | KTEMKCOWBIKGJP-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|