C10H18N2O5S — CID 54960068
2-[(1-methoxy-1-oxopropan-2-yl)carbamoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 54960068) has the molecular formula C10H18N2O5S and a molecular weight of 278.33 g/mol. Its IUPAC name is 2-[(1-methoxy-1-oxopropan-2-yl)carbamoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[(1-methoxy-1-oxopropan-2-yl)carbamoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 54960068 |
| Molecular Formula | C10H18N2O5S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-[(1-methoxy-1-oxopropan-2-yl)carbamoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | COC(=O)C(C)NC(=O)NC(CCSC)C(=O)O |
| InChI | InChI=1S/C10H18N2O5S/c1-6(9(15)17-2)11-10(16)12-7(8(13)14)4-5-18-3/h6-7H,4-5H2,1-3H3,(H,13,14)(H2,11,12,16) |
| InChIKey | GBTCTUBMVPLQLT-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |