C6H11NO4SZn — CID 174928260
(2S)-2-(carboxyamino)-4-methylsulfanylbutanoic acid;zinc (PubChem CID 174928260) has the molecular formula C6H11NO4SZn and a molecular weight of 258.61 g/mol. Its IUPAC name is (2S)-2-(carboxyamino)-4-methylsulfanylbutanoic acid;zinc.
| Compound Name | (2S)-2-(carboxyamino)-4-methylsulfanylbutanoic acid;zinc |
|---|---|
| PubChem CID | 174928260 |
| Molecular Formula | C6H11NO4SZn |
| Molecular Weight | 258.61 g/mol |
| Exact Mass | 256.97 |
| IUPAC Name | (2S)-2-(carboxyamino)-4-methylsulfanylbutanoic acid;zinc |
| SMILES | CSCC[C@H](NC(=O)O)C(=O)O.[Zn] |
| InChI | InChI=1S/C6H11NO4S.Zn/c1-12-3-2-4(5(8)9)7-6(10)11;/h4,7H,2-3H2,1H3,(H,8,9)(H,10,11);/t4-;/m0./s1 |
| InChIKey | RDXBREFFBVCADE-WCCKRBBISA-N |
| XLogP | 0.46 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.61 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|