C6H11NO2S3 — CID 71572902
2-(dithiocarboxyamino)-4-methylsulfanylbutanoic acid (PubChem CID 71572902) has the molecular formula C6H11NO2S3 and a molecular weight of 225.36 g/mol. Its IUPAC name is 2-(dithiocarboxyamino)-4-methylsulfanylbutanoic acid.
| Compound Name | 2-(dithiocarboxyamino)-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 71572902 |
| Molecular Formula | C6H11NO2S3 |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.00 |
| IUPAC Name | 2-(dithiocarboxyamino)-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=S)S)C(=O)O |
| InChI | InChI=1S/C6H11NO2S3/c1-12-3-2-4(5(8)9)7-6(10)11/h4H,2-3H2,1H3,(H,8,9)(H2,7,10,11) |
| InChIKey | MIJFIODMNPRSCG-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|