C7H13CaNO3S — CID 170843089
CID 170843089 (PubChem CID 170843089) has the molecular formula C7H13CaNO3S and a molecular weight of 231.33 g/mol.
| Compound Name | CID 170843089 |
|---|---|
| PubChem CID | 170843089 |
| Molecular Formula | C7H13CaNO3S |
| Molecular Weight | 231.33 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | — |
| SMILES | CSCCC(NC(C)=O)C(=O)O.[Ca] |
| InChI | InChI=1S/C7H13NO3S.Ca/c1-5(9)8-6(7(10)11)3-4-12-2;/h6H,3-4H2,1-2H3,(H,8,9)(H,10,11); |
| InChIKey | ZSIUQPNDYPYOCL-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.33 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |