C14H24N2O6S2Zn — CID 24847734
zinc bis((2S)-2-acetamido-4-methylsulfanylbutanoate) (PubChem CID 24847734) has the molecular formula C14H24N2O6S2Zn and a molecular weight of 445.88 g/mol. Its IUPAC name is zinc bis((2S)-2-acetamido-4-methylsulfanylbutanoate).
| Compound Name | zinc bis((2S)-2-acetamido-4-methylsulfanylbutanoate) |
|---|---|
| PubChem CID | 24847734 |
| Molecular Formula | C14H24N2O6S2Zn |
| Molecular Weight | 445.88 g/mol |
| Exact Mass | 444.04 |
| IUPAC Name | zinc bis((2S)-2-acetamido-4-methylsulfanylbutanoate) |
| SMILES | CSCC[C@H](NC(C)=O)C(=O)[O-].CSCC[C@H](NC(C)=O)C(=O)[O-].[Zn+2] |
| InChI | InChI=1S/2C7H13NO3S.Zn/c2*1-5(9)8-6(7(10)11)3-4-12-2;/h2*6H,3-4H2,1-2H3,(H,8,9)(H,10,11);/q;;+2/p-2/t2*6-;/m00./s1 |
| InChIKey | GZQSITXQBLWAKJ-UAIGZDOSSA-L |
| XLogP | -2.01 |
| TPSA | 138.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.88 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|