C10H20MgN2O6S2 — CID 141025880
magnesium bis((2S)-2-(hydroxyamino)-4-methylsulfanylbutanoate) (PubChem CID 141025880) has the molecular formula C10H20MgN2O6S2 and a molecular weight of 352.72 g/mol. Its IUPAC name is magnesium bis((2S)-2-(hydroxyamino)-4-methylsulfanylbutanoate).
| Compound Name | magnesium bis((2S)-2-(hydroxyamino)-4-methylsulfanylbutanoate) |
|---|---|
| PubChem CID | 141025880 |
| Molecular Formula | C10H20MgN2O6S2 |
| Molecular Weight | 352.72 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | magnesium bis((2S)-2-(hydroxyamino)-4-methylsulfanylbutanoate) |
| SMILES | CSCC[C@H](NO)C(=O)[O-].CSCC[C@H](NO)C(=O)[O-].[Mg+2] |
| InChI | InChI=1S/2C5H11NO3S.Mg/c2*1-10-3-2-4(6-9)5(7)8;/h2*4,6,9H,2-3H2,1H3,(H,7,8);/q;;+2/p-2/t2*4-;/m00./s1 |
| InChIKey | YNCVCPDRMQPQAB-SCGRZTRASA-L |
| XLogP | -2.71 |
| TPSA | 144.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.72 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|