C5H11NNiO3S — CID 174611803
2-(hydroxyamino)-4-methylsulfanylbutanoic acid;nickel (PubChem CID 174611803) has the molecular formula C5H11NNiO3S and a molecular weight of 223.91 g/mol. Its IUPAC name is 2-(hydroxyamino)-4-methylsulfanylbutanoic acid;nickel.
| Compound Name | 2-(hydroxyamino)-4-methylsulfanylbutanoic acid;nickel |
|---|---|
| PubChem CID | 174611803 |
| Molecular Formula | C5H11NNiO3S |
| Molecular Weight | 223.91 g/mol |
| Exact Mass | 222.98 |
| IUPAC Name | 2-(hydroxyamino)-4-methylsulfanylbutanoic acid;nickel |
| SMILES | CSCCC(NO)C(=O)O.[Ni] |
| InChI | InChI=1S/C5H11NO3S.Ni/c1-10-3-2-4(6-9)5(7)8;/h4,6,9H,2-3H2,1H3,(H,7,8); |
| InChIKey | DTZIZFDSNYSXNP-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.91 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|