C5H11Ca3NO11P2S — CID 175160326
tricalcium;2-(hydroxyamino)-4-methylsulfanylbutanoic acid;diphosphate (PubChem CID 175160326) has the molecular formula C5H11Ca3NO11P2S and a molecular weight of 475.39 g/mol. Its IUPAC name is tricalcium;2-(hydroxyamino)-4-methylsulfanylbutanoic acid;diphosphate.
| Compound Name | tricalcium;2-(hydroxyamino)-4-methylsulfanylbutanoic acid;diphosphate |
|---|---|
| PubChem CID | 175160326 |
| Molecular Formula | C5H11Ca3NO11P2S |
| Molecular Weight | 475.39 g/mol |
| Exact Mass | 474.84 |
| IUPAC Name | tricalcium;2-(hydroxyamino)-4-methylsulfanylbutanoic acid;diphosphate |
| SMILES | CSCCC(NO)C(=O)O.O=P([O-])([O-])[O-].O=P([O-])([O-])[O-].[Ca+2].[Ca+2].[Ca+2] |
| InChI | InChI=1S/C5H11NO3S.3Ca.2H3O4P/c1-10-3-2-4(6-9)5(7)8;;;;2*1-5(2,3)4/h4,6,9H,2-3H2,1H3,(H,7,8);;;;2*(H3,1,2,3,4)/q;3*+2;;/p-6 |
| InChIKey | MSUSRGFLAMNUDR-UHFFFAOYSA-H |
| XLogP | -6.62 |
| TPSA | 242.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.39 |
| LogP ≤ 5 | -6.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|