C6H13NO2S — CID 6451891
(2S)-2-(methylamino)-4-methylsulfanylbutanoic acid (PubChem CID 6451891) has the molecular formula C6H13NO2S and a molecular weight of 163.24 g/mol. Its IUPAC name is (2S)-2-(methylamino)-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-(methylamino)-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 6451891 |
| Molecular Formula | C6H13NO2S |
| Molecular Weight | 163.24 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | (2S)-2-(methylamino)-4-methylsulfanylbutanoic acid |
| SMILES | CN[C@@H](CCSC)C(=O)O |
| InChI | InChI=1S/C6H13NO2S/c1-7-5(6(8)9)3-4-10-2/h5,7H,3-4H2,1-2H3,(H,8,9)/t5-/m0/s1 |
| InChIKey | YAXAFCHJCYILRU-YFKPBYRVSA-N |
| XLogP | 0.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.24 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |