C5H11NO2S — CID 5288874
(2R)-2-(methylamino)-3-methylsulfanylpropanoic acid (PubChem CID 5288874) has the molecular formula C5H11NO2S and a molecular weight of 149.22 g/mol. Its IUPAC name is (2R)-2-(methylamino)-3-methylsulfanylpropanoic acid.
| Compound Name | (2R)-2-(methylamino)-3-methylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 5288874 |
| Molecular Formula | C5H11NO2S |
| Molecular Weight | 149.22 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | (2R)-2-(methylamino)-3-methylsulfanylpropanoic acid |
| SMILES | CN[C@@H](CSC)C(=O)O |
| InChI | InChI=1S/C5H11NO2S/c1-6-4(3-9-2)5(7)8/h4,6H,3H2,1-2H3,(H,7,8)/t4-/m0/s1 |
| InChIKey | WQSNCKZPJSHACB-BYPYZUCNSA-N |
| XLogP | 0.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.22 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |