C5H12N2OS — CID 54146412
2-(methylamino)-3-methylsulfanylpropanamide (PubChem CID 54146412) has the molecular formula C5H12N2OS and a molecular weight of 148.23 g/mol. Its IUPAC name is 2-(methylamino)-3-methylsulfanylpropanamide.
| Compound Name | 2-(methylamino)-3-methylsulfanylpropanamide |
|---|---|
| PubChem CID | 54146412 |
| Molecular Formula | C5H12N2OS |
| Molecular Weight | 148.23 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 2-(methylamino)-3-methylsulfanylpropanamide |
| SMILES | CNC(CSC)C(N)=O |
| InChI | InChI=1S/C5H12N2OS/c1-7-4(3-9-2)5(6)8/h4,7H,3H2,1-2H3,(H2,6,8) |
| InChIKey | OERPFMYSJLPQJN-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.23 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |