C7H16N2O — CID 89050865
(2R)-4-methyl-2-(methylamino)pentanamide (PubChem CID 89050865) has the molecular formula C7H16N2O and a molecular weight of 144.22 g/mol. Its IUPAC name is (2R)-4-methyl-2-(methylamino)pentanamide.
| Compound Name | (2R)-4-methyl-2-(methylamino)pentanamide |
|---|---|
| PubChem CID | 89050865 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | (2R)-4-methyl-2-(methylamino)pentanamide |
| SMILES | CN[C@H](CC(C)C)C(N)=O |
| InChI | InChI=1S/C7H16N2O/c1-5(2)4-6(9-3)7(8)10/h5-6,9H,4H2,1-3H3,(H2,8,10)/t6-/m1/s1 |
| InChIKey | FBFNXGHTGRJJHX-ZCFIWIBFSA-N |
| XLogP | 0.11 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |