C6H14N2O2 — CID 14584858
2-(hydroxyamino)-4-methylpentanamide (PubChem CID 14584858) has the molecular formula C6H14N2O2 and a molecular weight of 146.19 g/mol. Its IUPAC name is 2-(hydroxyamino)-4-methylpentanamide.
| Compound Name | 2-(hydroxyamino)-4-methylpentanamide |
|---|---|
| PubChem CID | 14584858 |
| Molecular Formula | C6H14N2O2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | 2-(hydroxyamino)-4-methylpentanamide |
| SMILES | CC(C)CC(NO)C(N)=O |
| InChI | InChI=1S/C6H14N2O2/c1-4(2)3-5(8-10)6(7)9/h4-5,8,10H,3H2,1-2H3,(H2,7,9) |
| InChIKey | RJMWCIUEXPGFPD-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|