C9H20N2O3S — CID 143275309
3-[(1-amino-4-methyl-1-oxopentan-2-yl)amino]propane-1-sulfinic acid (PubChem CID 143275309) has the molecular formula C9H20N2O3S and a molecular weight of 236.34 g/mol. Its IUPAC name is 3-[(1-amino-4-methyl-1-oxopentan-2-yl)amino]propane-1-sulfinic acid.
| Compound Name | 3-[(1-amino-4-methyl-1-oxopentan-2-yl)amino]propane-1-sulfinic acid |
|---|---|
| PubChem CID | 143275309 |
| Molecular Formula | C9H20N2O3S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 3-[(1-amino-4-methyl-1-oxopentan-2-yl)amino]propane-1-sulfinic acid |
| SMILES | CC(C)CC(NCCCS(=O)O)C(N)=O |
| InChI | InChI=1S/C9H20N2O3S/c1-7(2)6-8(9(10)12)11-4-3-5-15(13)14/h7-8,11H,3-6H2,1-2H3,(H2,10,12)(H,13,14) |
| InChIKey | NOUCVARWSYQEFF-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|