C8H19N2O2P — CID 59929035
(2S)-2-(dimethylphosphorylamino)-4-methylpentanamide (PubChem CID 59929035) has the molecular formula C8H19N2O2P and a molecular weight of 206.23 g/mol. Its IUPAC name is (2S)-2-(dimethylphosphorylamino)-4-methylpentanamide.
| Compound Name | (2S)-2-(dimethylphosphorylamino)-4-methylpentanamide |
|---|---|
| PubChem CID | 59929035 |
| Molecular Formula | C8H19N2O2P |
| Molecular Weight | 206.23 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | (2S)-2-(dimethylphosphorylamino)-4-methylpentanamide |
| SMILES | CC(C)C[C@H](NP(C)(C)=O)C(N)=O |
| InChI | InChI=1S/C8H19N2O2P/c1-6(2)5-7(8(9)11)10-13(3,4)12/h6-7H,5H2,1-4H3,(H2,9,11)(H,10,12)/t7-/m0/s1 |
| InChIKey | WVTMQUTXOOGSRP-ZETCQYMHSA-N |
| XLogP | 1.01 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|